Don't have an account? Register!
GNPS Public Spectral Library
View  | Lib | Name | Adduct | MZ | Inst | PI | Quality | User | Time | Structure | |
|---|---|---|---|---|---|---|---|---|---|---|---|
| Filter By: | ~ | ||||||||||
 1 | CCMSLIB00001058235 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide6_Fuberidazole_C11H8N2O_2-(2-Furyl)-1H-benzimidazole | M-H | 183.06 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 2 | CCMSLIB00001058238 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide6_Ethirimol_C11H19N3O_882476 | M-H | 208.15 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 3 | CCMSLIB00001058241 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide6_Diniconazole_C15H17Cl2N3O_(1E)-1-(2,4-Dichlorphenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol | M+FA-H | 370.07 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 4 | CCMSLIB00001058242 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Fluometuron_C10H11F3N2O_Urea, N,N-dimethyl-N'-[3-(trifluoromethyl)phenyl]- | M-H | 231.07 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 5 | CCMSLIB00001058245 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Forchlorfenuron_C12H10ClN3O_Urea, N-(2-chloro-4-pyridinyl)-N'-phenyl- | M-H | 246.04 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 6 | CCMSLIB00001058248 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Forchlorfenuron_C12H10ClN3O_Urea, N-(2-chloro-4-pyridinyl)-N'-phenyl- | M+Cl | 282.02 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 7 | CCMSLIB00001058251 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Forchlorfenuron_C12H10ClN3O_Urea, N-(2-chloro-4-pyridinyl)-N'-phenyl- | M+FA-H | 292.05 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 8 | CCMSLIB00001058256 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Chlorotoluron_C10H13ClN2O_Urea, N'-(3-chloro-4-methylphenyl)-N,N-dimethyl- | M-H | 211.06 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 9 | CCMSLIB00001058257 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Diuron_C9H10Cl2N2O_3-(3,4-Dichlorophenyl)-1,1-dimethylurea | M-H | 231.01 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 10 | CCMSLIB00001058264 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Diflubenzuron_C14H9ClF2N2O2_N-[(4-Chlorophenyl)carbamoyl]-2,6-difluorobenzamide | M-H | 309.02 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 11 | CCMSLIB00001058267 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Neburon_C12H16Cl2N2O_Urea, N-butyl-N'-(3,4-dichlorophenyl)-N-methyl- | M-H | 273.06 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 12 | CCMSLIB00001058269 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Triflumuron_C15H10ClF3N2O3_Benzamide, 2-chloro-N-[[[4-(trifluoromethoxy)phenyl]amino]carbonyl]- | M-H | 357.03 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 13 | CCMSLIB00001058272 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Hexaflumuron_C16H8Cl2F6N2O3_ | M-H | 458.98 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 14 | CCMSLIB00001058277 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Novaluron_C17H9ClF8N2O4_N-({3-Chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl}carbamoyl)-2,6-difluorobenzamide | M-H | 491.00 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 15 | CCMSLIB00001058278 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Novaluron_C17H9ClF8N2O4_N-({3-Chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl}carbamoyl)-2,6-difluorobenzamide | M-H2O-H | 472.99 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 16 | CCMSLIB00001058282 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Novaluron_C17H9ClF8N2O4_N-({3-Chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl}carbamoyl)-2,6-difluorobenzamide | M+Cl | 526.98 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 17 | CCMSLIB00001058285 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Teflubenzuron_C14H6Cl2F4N2O2_N-[(3,5-Dichloro-2,4-difluorophenyl)carbamoyl]-2,6-difluorobenzamide | M-H | 378.97 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 18 | CCMSLIB00001058289 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Lufenuron_C17H8Cl2F8N2O3_N-[[[2,5-Dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]amino]carbonyl]-2,6-difluorobenzamide | M-H | 508.97 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 19 | CCMSLIB00001058291 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Hexaflumuron_C16H8Cl2F6N2O3_ | M-H | 458.98 | Maxis HD qTOF | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:15:00.0 | |
| 20 | CCMSLIB00001058293 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Flufenoxuron_C21H11ClF6N2O3_N-({4-[2-Chloro-4-(trifluoromethyl)phenoxy]-2-fluorophenyl}carbamoyl)-2,6-difluorobenzamide | M-H | 487.03 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 21 | CCMSLIB00001058295 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Novaluron_C17H9ClF8N2O4_N-({3-Chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl}carbamoyl)-2,6-difluorobenzamide | M-H | 491.00 | Maxis HD qTOF | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:15:00.0 | |
| 22 | CCMSLIB00001058297 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Novaluron_C17H9ClF8N2O4_N-({3-Chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl}carbamoyl)-2,6-difluorobenzamide | M+Cl | 526.98 | Maxis HD qTOF | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:15:00.0 | |
| 23 | CCMSLIB00001058298 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Chlorfluazuron_C20H9Cl3F5N3O3_Benzamide, N-[[[3,5-dichloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]amino]carbonyl]-2,6-difluoro- | M-H | 537.96 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 24 | CCMSLIB00001058300 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Lufenuron_C17H8Cl2F8N2O3_N-[[[2,5-Dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]amino]carbonyl]-2,6-difluorobenzamide | M-H | 508.97 | Maxis HD qTOF | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:15:00.0 | |
| 25 | CCMSLIB00001058303 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide1_Acephate_C4H10NO3PS_O,S-Dimethyl acetylphosphoramidothioate | M-H | 182.00 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 26 | CCMSLIB00001058305 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Flufenoxuron_C21H11ClF6N2O3_N-({4-[2-Chloro-4-(trifluoromethyl)phenoxy]-2-fluorophenyl}carbamoyl)-2,6-difluorobenzamide | M-H | 487.03 | Maxis HD qTOF | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:15:00.0 | |
| 27 | CCMSLIB00001058306 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide4_Dinotefuran_C7H14N4O3_Guanidine, N-methyl-N''-nitro-N'-[(tetrahydro-3-furanyl)methyl]- | M-H | 201.10 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 28 | CCMSLIB00001058309 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide3_Chlorfluazuron_C20H9Cl3F5N3O3_Benzamide, N-[[[3,5-dichloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]amino]carbonyl]-2,6-difluoro- | M-H | 537.96 | Maxis HD qTOF | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:15:00.0 | |
| 29 | CCMSLIB00001058310 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide4_Flonicamid_C9H6F3N3O_N-(Cyanomethyl)-4-(trifluoromethyl)nicotinamide | M-H | 228.04 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:12:25.0 | |
| 30 | CCMSLIB00001058312 | GNPS-COLLECTIONS-PESTICIDES-NEGATIVE | Pesticide5_Sulfentrazone_C11H10Cl2F2N4O3S_N-{2,4-Dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl]phenyl}methanesulfonamide | M-H | 384.98 | Maxis HD qTOF | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:15:00.0 | |
Go to