Don't have an account? Register!
GNPS Public Spectral Library
View  | Lib | Name | Adduct | MZ | Inst | PI | Quality | User | Time | Structure | |
|---|---|---|---|---|---|---|---|---|---|---|---|
| Filter By: | ~ | ||||||||||
 1 | CCMSLIB00001058205 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_3-Hydroxycarbofuran_C12H15NO4_3,7-Benzofurandiol, 2,3-dihydro-2,2-dimethyl-, 7-(methylcarbamate) | M+H | 238.11 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 2 | CCMSLIB00001058207 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_3-Hydroxycarbofuran_C12H15NO4_3,7-Benzofurandiol, 2,3-dihydro-2,2-dimethyl-, 7-(methylcarbamate) | M-H2O+H | 220.10 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 3 | CCMSLIB00001058209 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Dioxacarb_C11H13NO4_Phenol, 2-(1,3-dioxolan-2-yl)-, methylcarbamate | M+H | 224.09 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 4 | CCMSLIB00001058211 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Fenuron_C9H12N2O_Urea, N,N-dimethyl-N'-phenyl- | M+H | 165.10 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 5 | CCMSLIB00001058213 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Fenuron_C9H12N2O_Urea, N,N-dimethyl-N'-phenyl- | M+NH4 | 182.13 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 6 | CCMSLIB00001058217 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Propoxur_C11H15NO3_Baygon | M+H | 210.11 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 7 | CCMSLIB00001058220 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Carbofuran_C12H15NO3_Furadan | M+H | 222.11 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 8 | CCMSLIB00001058221 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Pirimicarb_C11H18N4O2_2-(Dimethylamino)-5,6-dimethyl-4-pyrimidinyl dimethylcarbamate | M+H | 239.15 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 9 | CCMSLIB00001058223 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Fluometuron_C10H11F3N2O_Urea, N,N-dimethyl-N'-[3-(trifluoromethyl)phenyl]- | M+H | 233.09 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 10 | CCMSLIB00001058225 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Isoprocarb_C11H15NO2_2-Isopropylphenyl methylcarbamate | M+H | 194.12 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 11 | CCMSLIB00001058227 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Monolinuron_C9H11ClN2O2_Urea, N'-(4-chlorophenyl)-N-methoxy-N-methyl- | M+H | 215.06 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 12 | CCMSLIB00001058229 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Forchlorfenuron_C12H10ClN3O_Urea, N-(2-chloro-4-pyridinyl)-N'-phenyl- | M+H | 248.06 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 13 | CCMSLIB00001058231 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Metobromuron_C9H11BrN2O2_Urea, N'-(4-bromophenyl)-N-methoxy-N-methyl- | M+H | 259.01 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 14 | CCMSLIB00001058234 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Chlorotoluron_C10H13ClN2O_Urea, N'-(3-chloro-4-methylphenyl)-N,N-dimethyl- | M+H | 213.08 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 15 | CCMSLIB00001058236 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Isoproturon_C12H18N2O_Arelon | M+H | 207.15 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 16 | CCMSLIB00001058239 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Fenobucarb_C12H17NO2_Bassa | M+H | 208.13 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 17 | CCMSLIB00001058243 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Diuron_C9H10Cl2N2O_3-(3,4-Dichlorophenyl)-1,1-dimethylurea | M+H | 233.02 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 18 | CCMSLIB00001058249 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Diethofencarb_C14H21NO4_Powmil | M+H | 268.15 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 19 | CCMSLIB00001058252 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Cycluron_C11H22N2O_3-Cyclooctyl-1,1-dimethylurea | M+H | 199.18 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 20 | CCMSLIB00001058258 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Linuron_C9H10Cl2N2O2_Urea, N'-(3,4-dichlorophenyl)-N-methoxy-N-methyl- | M+H | 249.02 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 21 | CCMSLIB00001058261 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Iprovalicarb Isomer 1*_C18H28N2O3_Isopropyl [(2S)-3-methyl-1-{[1-(4-methylphenyl)ethyl]amino}-1-oxo-2-butanyl]carbamate | M+H | 321.22 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 22 | CCMSLIB00001058263 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Iprovalicarb Isomer 1*_C18H28N2O3_Isopropyl [(2S)-3-methyl-1-{[1-(4-methylphenyl)ethyl]amino}-1-oxo-2-butanyl]carbamate | M+Na | 343.20 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 23 | CCMSLIB00001058266 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Bifenazate_C17H20N2O3_1-Methylethyl 2-(4-methoxybiphenyl-3-yl)hydrazinecarboxylate | M+H | 301.15 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 24 | CCMSLIB00001058270 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Bifenazate_C17H20N2O3_1-Methylethyl 2-(4-methoxybiphenyl-3-yl)hydrazinecarboxylate | M+Na | 323.14 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 25 | CCMSLIB00001058273 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Chloroxuron_C15H15ClN2O2_Urea, N'-[4-(4-chlorophenoxy)phenyl]-N,N-dimethyl- | M+H | 291.09 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 26 | CCMSLIB00001058275 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Fenoxycarb_C17H19NO4_[2-(4-Phenoxyphenoxy)ethyl]carbamic acid ethyl ester | M+H | 302.14 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 27 | CCMSLIB00001058279 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Neburon_C12H16Cl2N2O_Urea, N-butyl-N'-(3,4-dichlorophenyl)-N-methyl- | M+H | 275.07 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 28 | CCMSLIB00001058281 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Pyraclostrobin_C19H18ClN3O4_Methyl [2-({[1-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy}methyl)phenyl]methoxycarbamate | M+H | 388.11 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
| 29 | CCMSLIB00001058284 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide10_Carbendazim_C9H9N3O2_mecarzole | M+H | 192.08 | Q-Exactive Plus Orbitrap Res 70k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:14:30.0 | |
| 30 | CCMSLIB00001058286 | GNPS-COLLECTIONS-PESTICIDES-POSITIVE | Pesticide3_Pyraclostrobin_C19H18ClN3O4_Methyl [2-({[1-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy}methyl)phenyl]methoxycarbamate | M+Na | 410.09 | Q-Exactive Plus Orbitrap Res 14k | Dorrestein/Touboul | 1 | mwang87 | 2017-03-21 12:10:26.0 | |
Go to